Products 956437-05-1
CAS 956437-05-1 is the registry number for 2-{4-(4-(carbamoylmethoxy)phenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl}acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[4-[4-(2-amino-2-oxoethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetic acid (CAS 956437-05-1) is a chemical compound with the molecular formula C14H15N3O6 and a molecular weight of 321.28 g/mol. IUPAC name: 2-[4-[4-(2-amino-2-oxoethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetic acid. InChIKey: YGHFMUMNUYJCDA-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O6 |
|---|---|
| Molecular weight | 321.28 g/mol |
| IUPAC name | 2-[4-[4-(2-amino-2-oxoethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetic acid |
| InChIKey | YGHFMUMNUYJCDA-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(C(=O)N1)CC(=O)O)C2=CC=C(C=C2)OCC(=O)N |
Computed by PubChem (NCBI)