CAS 956505-57-0 is the registry number for 1-Phenyl-3-(5,6,7,8-tetrahydronaphthalen-2-yl)-1h-pyrazol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
1-phenyl-3-(5,6,7,8-tetrahydronaphthalen-2-yl)pyrazol-5-amine (CAS 956505-57-0) is a chemical compound with the molecular formula C19H19N3 and a molecular weight of 289.4 g/mol. IUPAC name: 1-phenyl-3-(5,6,7,8-tetrahydronaphthalen-2-yl)pyrazol-5-amine. InChIKey: ACFDSTIGSDIANU-UHFFFAOYSA-N.
| Molecular formula | C19H19N3 |
|---|---|
| Molecular weight | 289.4 g/mol |
| IUPAC name | 1-phenyl-3-(5,6,7,8-tetrahydronaphthalen-2-yl)pyrazol-5-amine |
| InChIKey | ACFDSTIGSDIANU-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=CC(=C2)C3=NN(C(=C3)N)C4=CC=CC=C4 |
Computed by PubChem (NCBI)