Products 956508-24-0
CAS 956508-24-0 is the registry number for Vildagliptin Impurity 38. Offered by: Chemat Brand. Available pack sizes: on request.
[(5S,7R)-3-amino-1-adamantyl] nitrate (CAS 956508-24-0) is a chemical compound with the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. IUPAC name: [(5S,7R)-3-amino-1-adamantyl] nitrate. InChIKey: ROIZUFMNAWKLHK-BQKDNTBBSA-N.
| Molecular formula | C10H16N2O3 |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | [(5S,7R)-3-amino-1-adamantyl] nitrate |
| InChIKey | ROIZUFMNAWKLHK-BQKDNTBBSA-N |
| SMILES | C1[C@@H]2CC3(C[C@H]1CC(C2)(C3)O[N+](=O)[O-])N |
Computed by PubChem (NCBI)