CAS 95656-68-1 is the registry number for Mapenterol. Offered by: TRC. Available pack sizes: 250mg.
1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-(2-methylbutan-2-ylamino)ethanol (CAS 95656-68-1) is a chemical compound with the molecular formula C14H20ClF3N2O and a molecular weight of 324.77 g/mol. IUPAC name: 1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-(2-methylbutan-2-ylamino)ethanol. InChIKey: KGOIKOVSEVRHNH-UHFFFAOYSA-N.
| Molecular formula | C14H20ClF3N2O |
|---|---|
| Molecular weight | 324.77 g/mol |
| IUPAC name | 1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-(2-methylbutan-2-ylamino)ethanol |
| InChIKey | KGOIKOVSEVRHNH-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)NCC(C1=CC(=C(C(=C1)Cl)N)C(F)(F)F)O |
Computed by PubChem (NCBI)