CAS 956568-50-6 is the registry number for 2-({1-((4-chlorophenyl)methyl)-4-formyl-3-methyl-1H-pyrazol-5-yl}sulfanyl)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[1-[(4-chlorophenyl)methyl]-4-formyl-3-methylpyrazol-5-yl]sulfanylacetic acid (CAS 956568-50-6) is a chemical compound with the molecular formula C14H13ClN2O3S and a molecular weight of 324.8 g/mol. IUPAC name: 2-[1-[(4-chlorophenyl)methyl]-4-formyl-3-methylpyrazol-5-yl]sulfanylacetic acid. InChIKey: ADXLMTLALRUHFD-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2O3S |
|---|---|
| Molecular weight | 324.8 g/mol |
| IUPAC name | 2-[1-[(4-chlorophenyl)methyl]-4-formyl-3-methylpyrazol-5-yl]sulfanylacetic acid |
| InChIKey | ADXLMTLALRUHFD-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1C=O)SCC(=O)O)CC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)