CAS 956576-60-6 appears in our catalog under these names: 1-[(4-Isothiocyanatophenyl)sulfonyl]azepane, 95%, 1-((4-Isothiocyanatophenyl)sulfonyl)azepane, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
1-(4-isothiocyanatophenyl)sulfonylazepane (CAS 956576-60-6) is a chemical compound with the molecular formula C13H16N2O2S2 and a molecular weight of 296.4 g/mol. IUPAC name: 1-(4-isothiocyanatophenyl)sulfonylazepane. InChIKey: DXVSAGFLARHWIP-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O2S2 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | 1-(4-isothiocyanatophenyl)sulfonylazepane |
| InChIKey | DXVSAGFLARHWIP-UHFFFAOYSA-N |
| SMILES | C1CCCN(CC1)S(=O)(=O)C2=CC=C(C=C2)N=C=S |
Computed by PubChem (NCBI)