CAS 956576-68-4 appears in our catalog under these names: 1-[(4-Isothiocyanatophenyl)sulfonyl]-2,6-dimethylpiperidine, 95%, 1-((4-Isothiocyanatophenyl)sulfonyl)-2,6-dimethylpiperidine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
1-(4-isothiocyanatophenyl)sulfonyl-2,6-dimethylpiperidine (CAS 956576-68-4) is a chemical compound with the molecular formula C14H18N2O2S2 and a molecular weight of 310.4 g/mol. IUPAC name: 1-(4-isothiocyanatophenyl)sulfonyl-2,6-dimethylpiperidine. InChIKey: XDYJHECGSLGEFR-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O2S2 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 1-(4-isothiocyanatophenyl)sulfonyl-2,6-dimethylpiperidine |
| InChIKey | XDYJHECGSLGEFR-UHFFFAOYSA-N |
| SMILES | CC1CCCC(N1S(=O)(=O)C2=CC=C(C=C2)N=C=S)C |
Computed by PubChem (NCBI)