CAS 956613-01-7 appears in our catalog under these names: SB-633825, 98%, SB-633825, SB–633825, SB-633825, 98.52%, 98.52%, SB-633825, 98.05%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 2mg, 5mg, 25mg, 50mg, 10mg, 1mg, 10 mg.
4-[5-(6-methoxynaphthalen-2-yl)-1-methyl-2-(2-methyl-4-methylsulfonylphenyl)imidazol-4-yl]pyridine (CAS 956613-01-7) is a chemical compound with the molecular formula C28H25N3O3S and a molecular weight of 483.6 g/mol. IUPAC name: 4-[5-(6-methoxynaphthalen-2-yl)-1-methyl-2-(2-methyl-4-methylsulfonylphenyl)imidazol-4-yl]pyridine. InChIKey: ZDSNJSQTPLXCSG-UHFFFAOYSA-N.
| Molecular formula | C28H25N3O3S |
|---|---|
| Molecular weight | 483.6 g/mol |
| IUPAC name | 4-[5-(6-methoxynaphthalen-2-yl)-1-methyl-2-(2-methyl-4-methylsulfonylphenyl)imidazol-4-yl]pyridine |
| InChIKey | ZDSNJSQTPLXCSG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)S(=O)(=O)C)C2=NC(=C(N2C)C3=CC4=C(C=C3)C=C(C=C4)OC)C5=CC=NC=C5 |
Computed by PubChem (NCBI)