CAS 956713-96-5 appears in our catalog under these names: 5-Chloro-1-((2,4-dichlorophenyl)methyl)-3-methyl-1H-pyrazole-4-carboxylic acid, 95%, 5-Chloro-1-((2,4-dichlorophenyl)methyl)-3-methyl-1H-pyrazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
5-chloro-1-[(2,4-dichlorophenyl)methyl]-3-methylpyrazole-4-carboxylic acid (CAS 956713-96-5) is a chemical compound with the molecular formula C12H9Cl3N2O2 and a molecular weight of 319.6 g/mol. IUPAC name: 5-chloro-1-[(2,4-dichlorophenyl)methyl]-3-methylpyrazole-4-carboxylic acid. InChIKey: BELUEBJZBIVMOB-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl3N2O2 |
|---|---|
| Molecular weight | 319.6 g/mol |
| IUPAC name | 5-chloro-1-[(2,4-dichlorophenyl)methyl]-3-methylpyrazole-4-carboxylic acid |
| InChIKey | BELUEBJZBIVMOB-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1C(=O)O)Cl)CC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)