CAS 95672-63-2 appears in our catalog under these names: 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-iodo-a-D-glucopyranose, (2R,3R,4S,5R,6R)–6–(acetoxymethyl)–3–iodotetrahydro–2H–pyran–2,4,5–triyl triacetate. Offered by: Biosynth, Chemat, GLPBio. Available pack sizes: 100mg, 50mg, 1g, 250mg, 2g, 500mg, 1000mg.
[(2R,3R,4S,5R)-3,4,6-triacetyloxy-5-iodooxan-2-yl]methyl acetate (CAS 95672-63-2) is a chemical compound with the molecular formula C14H19IO9 and a molecular weight of 458.20 g/mol. IUPAC name: [(2R,3R,4S,5R)-3,4,6-triacetyloxy-5-iodooxan-2-yl]methyl acetate. InChIKey: KXQRSYVDKIOQHJ-GNMOMJPPSA-N.
| Molecular formula | C14H19IO9 |
|---|---|
| Molecular weight | 458.20 g/mol |
| IUPAC name | [(2R,3R,4S,5R)-3,4,6-triacetyloxy-5-iodooxan-2-yl]methyl acetate |
| InChIKey | KXQRSYVDKIOQHJ-GNMOMJPPSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H](C(O1)OC(=O)C)I)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)