CAS 956781-87-6 is the registry number for 6-Chloro-N-(3-methyl-1-phenyl-1H-pyrazol-5-yl)pyridazin-3-amine. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
6-chloro-N-(5-methyl-2-phenylpyrazol-3-yl)pyridazin-3-amine (CAS 956781-87-6) is a chemical compound with the molecular formula C14H12ClN5 and a molecular weight of 285.73 g/mol. IUPAC name: 6-chloro-N-(5-methyl-2-phenylpyrazol-3-yl)pyridazin-3-amine. InChIKey: LWGJAMPEUMEJHD-UHFFFAOYSA-N.
| Molecular formula | C14H12ClN5 |
|---|---|
| Molecular weight | 285.73 g/mol |
| IUPAC name | 6-chloro-N-(5-methyl-2-phenylpyrazol-3-yl)pyridazin-3-amine |
| InChIKey | LWGJAMPEUMEJHD-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)NC2=NN=C(C=C2)Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)