Products 957013-17-1
CAS 957013-17-1 is the registry number for 1-(3-Chlorophenyl)-5-(furan-2-yl)-1H-pyrazole-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(3-chlorophenyl)-5-(furan-2-yl)pyrazole-3-carboxylic acid (CAS 957013-17-1) is a chemical compound with the molecular formula C14H9ClN2O3 and a molecular weight of 288.68 g/mol. IUPAC name: 1-(3-chlorophenyl)-5-(furan-2-yl)pyrazole-3-carboxylic acid. InChIKey: ZSJXBAZRVIEQCK-UHFFFAOYSA-N.
| Molecular formula | C14H9ClN2O3 |
|---|---|
| Molecular weight | 288.68 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-5-(furan-2-yl)pyrazole-3-carboxylic acid |
| InChIKey | ZSJXBAZRVIEQCK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)N2C(=CC(=N2)C(=O)O)C3=CC=CO3 |
Computed by PubChem (NCBI)