CAS 957023-24-4 is the registry number for (4-Chloro-3-nitro-1H-pyrazol-1-yl)methanol. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
(4-chloro-3-nitropyrazol-1-yl)methanol (CAS 957023-24-4) is a chemical compound with the molecular formula C4H4ClN3O3 and a molecular weight of 177.54 g/mol. IUPAC name: (4-chloro-3-nitropyrazol-1-yl)methanol. InChIKey: MRWJHTWUGHYVHZ-UHFFFAOYSA-N.
| Molecular formula | C4H4ClN3O3 |
|---|---|
| Molecular weight | 177.54 g/mol |
| IUPAC name | (4-chloro-3-nitropyrazol-1-yl)methanol |
| InChIKey | MRWJHTWUGHYVHZ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NN1CO)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)