Products 957034-79-6

CAS 957034-79-6 is the registry number for 3-Bromo-5-methylaniline hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 100g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-bromo-5-methylaniline;hydrochloride (CAS 957034-79-6) is a chemical compound with the molecular formula C7H9BrClN and a molecular weight of 222.51 g/mol. IUPAC name: 3-bromo-5-methylaniline;hydrochloride. InChIKey: ZGMJEUXFWOIXOG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9BrClN
Molecular weight222.51 g/mol
IUPAC name3-bromo-5-methylaniline;hydrochloride
InChIKeyZGMJEUXFWOIXOG-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1)Br)N.Cl

Computed by PubChem (NCBI)