CAS 957035-42-6 appears in our catalog under these names: trans-4-(Boc-amino)cyclohexyl tosylate, 98%, trans-4-((tert-Butoxycarbonyl)amino)cyclohexyl 4-methylbenzenesulfonate, 98%(LC-MS),RG, 98%(LC-MS),RG. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl] 4-methylbenzenesulfonate (CAS 957035-42-6) is a chemical compound with the molecular formula C18H27NO5S and a molecular weight of 369.5 g/mol. IUPAC name: [4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl] 4-methylbenzenesulfonate. InChIKey: SVBOYWVVBMKJDS-UHFFFAOYSA-N.
| Molecular formula | C18H27NO5S |
|---|---|
| Molecular weight | 369.5 g/mol |
| IUPAC name | [4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl] 4-methylbenzenesulfonate |
| InChIKey | SVBOYWVVBMKJDS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2CCC(CC2)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)