CAS 957060-87-6 appears in our catalog under these names: 1,3-Bis(3-boronophenyl)urea, 97%, ((Carbonylbis(azanediyl))bis(3,1-phenylene))diboronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g.
[3-[(3-boronophenyl)carbamoylamino]phenyl]boronic acid (CAS 957060-87-6) is a chemical compound with the molecular formula C13H14B2N2O5 and a molecular weight of 299.9 g/mol. IUPAC name: [3-[(3-boronophenyl)carbamoylamino]phenyl]boronic acid. InChIKey: UQUQNYFFKZOTSS-UHFFFAOYSA-N.
| Molecular formula | C13H14B2N2O5 |
|---|---|
| Molecular weight | 299.9 g/mol |
| IUPAC name | [3-[(3-boronophenyl)carbamoylamino]phenyl]boronic acid |
| InChIKey | UQUQNYFFKZOTSS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)NC(=O)NC2=CC=CC(=C2)B(O)O)(O)O |
Computed by PubChem (NCBI)