CAS 957060-92-3 appears in our catalog under these names: 3-(4-Methylpiperazine-1-carbonyl)phenylboronic acid hydrochloride, 98%, (3-(4-Methylpiperazine-1-carbonyl)phenyl)boronic acid hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
[3-(4-methylpiperazine-1-carbonyl)phenyl]boronic acid;hydrochloride (CAS 957060-92-3) is a chemical compound with the molecular formula C12H18BClN2O3 and a molecular weight of 284.55 g/mol. IUPAC name: [3-(4-methylpiperazine-1-carbonyl)phenyl]boronic acid;hydrochloride. InChIKey: HVQOCKSJONHMKQ-UHFFFAOYSA-N.
| Molecular formula | C12H18BClN2O3 |
|---|---|
| Molecular weight | 284.55 g/mol |
| IUPAC name | [3-(4-methylpiperazine-1-carbonyl)phenyl]boronic acid;hydrochloride |
| InChIKey | HVQOCKSJONHMKQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)N2CCN(CC2)C)(O)O.Cl |
Computed by PubChem (NCBI)