CAS 957061-02-8 is the registry number for 4-(1H-Pyrazol-1-ylsulfonyl)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(4-pyrazol-1-ylsulfonylphenyl)boronic acid (CAS 957061-02-8) is a chemical compound with the molecular formula C9H9BN2O4S and a molecular weight of 252.06 g/mol. IUPAC name: (4-pyrazol-1-ylsulfonylphenyl)boronic acid. InChIKey: JEIPACYLLOVWOL-UHFFFAOYSA-N.
| Molecular formula | C9H9BN2O4S |
|---|---|
| Molecular weight | 252.06 g/mol |
| IUPAC name | (4-pyrazol-1-ylsulfonylphenyl)boronic acid |
| InChIKey | JEIPACYLLOVWOL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)N2C=CC=N2)(O)O |
Computed by PubChem (NCBI)