CAS 957061-06-2 is the registry number for 3-((2-(Mesitylsulfonyl)hydrazono)methyl)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 100g, 1g.
[3-[(E)-[(2,4,6-trimethylphenyl)sulfonylhydrazinylidene]methyl]phenyl]boronic acid (CAS 957061-06-2) is a chemical compound with the molecular formula C16H19BN2O4S and a molecular weight of 346.2 g/mol. IUPAC name: [3-[(E)-[(2,4,6-trimethylphenyl)sulfonylhydrazinylidene]methyl]phenyl]boronic acid. InChIKey: CNCIYFHRILXDLV-VCHYOVAHSA-N.
| Molecular formula | C16H19BN2O4S |
|---|---|
| Molecular weight | 346.2 g/mol |
| IUPAC name | [3-[(E)-[(2,4,6-trimethylphenyl)sulfonylhydrazinylidene]methyl]phenyl]boronic acid |
| InChIKey | CNCIYFHRILXDLV-VCHYOVAHSA-N |
| SMILES | B(C1=CC(=CC=C1)/C=N/NS(=O)(=O)C2=C(C=C(C=C2C)C)C)(O)O |
Computed by PubChem (NCBI)