CAS 957061-10-8 is the registry number for 4-(2-(1,3-Dioxoisoindolin-2-yl)ethoxy)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 100mg, 50mg.
[4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]phenyl]boronic acid (CAS 957061-10-8) is a chemical compound with the molecular formula C16H14BNO5 and a molecular weight of 311.1 g/mol. IUPAC name: [4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]phenyl]boronic acid. InChIKey: CFRXLUKYUVSWFV-UHFFFAOYSA-N.
| Molecular formula | C16H14BNO5 |
|---|---|
| Molecular weight | 311.1 g/mol |
| IUPAC name | [4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]phenyl]boronic acid |
| InChIKey | CFRXLUKYUVSWFV-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCCN2C(=O)C3=CC=CC=C3C2=O)(O)O |
Computed by PubChem (NCBI)