CAS 957062-98-5 is the registry number for 4-Trifluoromethoxyphenyl 4-boronobenzenesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
[4-[[4-(trifluoromethoxy)phenyl]sulfamoyl]phenyl]boronic acid (CAS 957062-98-5) is a chemical compound with the molecular formula C13H11BF3NO5S and a molecular weight of 361.1 g/mol. IUPAC name: [4-[[4-(trifluoromethoxy)phenyl]sulfamoyl]phenyl]boronic acid. InChIKey: SZIKGKUJHXEEAH-UHFFFAOYSA-N.
| Molecular formula | C13H11BF3NO5S |
|---|---|
| Molecular weight | 361.1 g/mol |
| IUPAC name | [4-[[4-(trifluoromethoxy)phenyl]sulfamoyl]phenyl]boronic acid |
| InChIKey | SZIKGKUJHXEEAH-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)NC2=CC=C(C=C2)OC(F)(F)F)(O)O |
Computed by PubChem (NCBI)