Products 957065-85-9
CAS 957065-85-9 appears in our catalog under these names: 2–Ethoxy–5–methoxyphenylboronic acid, 2-Ethoxy-5-methoxyphenylboronic acid, 97%, 97%, 2-Ethoxy-5-methoxyphenylboronic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g.
(2-ethoxy-5-methoxyphenyl)boronic acid (CAS 957065-85-9) is a chemical compound with the molecular formula C9H13BO4 and a molecular weight of 196.01 g/mol. IUPAC name: (2-ethoxy-5-methoxyphenyl)boronic acid. InChIKey: QZURUWKQPQTXPR-UHFFFAOYSA-N.
| Molecular formula | C9H13BO4 |
|---|---|
| Molecular weight | 196.01 g/mol |
| IUPAC name | (2-ethoxy-5-methoxyphenyl)boronic acid |
| InChIKey | QZURUWKQPQTXPR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OC)OCC)(O)O |
Computed by PubChem (NCBI)