CAS 957066-06-7 is the registry number for 5-Borono-4-chloro-2-fluorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-borono-4-chloro-2-fluorobenzoic acid (CAS 957066-06-7) is a chemical compound with the molecular formula C7H5BClFO4 and a molecular weight of 218.38 g/mol. IUPAC name: 5-borono-4-chloro-2-fluorobenzoic acid. InChIKey: VDGDGSCIDRLTGU-UHFFFAOYSA-N.
| Molecular formula | C7H5BClFO4 |
|---|---|
| Molecular weight | 218.38 g/mol |
| IUPAC name | 5-borono-4-chloro-2-fluorobenzoic acid |
| InChIKey | VDGDGSCIDRLTGU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)F)C(=O)O)(O)O |
Computed by PubChem (NCBI)