Products 957066-06-7

CAS 957066-06-7 is the registry number for 5-Borono-4-chloro-2-fluorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

5-borono-4-chloro-2-fluorobenzoic acid (CAS 957066-06-7) is a chemical compound with the molecular formula C7H5BClFO4 and a molecular weight of 218.38 g/mol. IUPAC name: 5-borono-4-chloro-2-fluorobenzoic acid. InChIKey: VDGDGSCIDRLTGU-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BClFO4
Molecular weight218.38 g/mol
IUPAC name5-borono-4-chloro-2-fluorobenzoic acid
InChIKeyVDGDGSCIDRLTGU-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1Cl)F)C(=O)O)(O)O

Computed by PubChem (NCBI)