CAS 957066-10-3 appears in our catalog under these names: 4-(N-(3-Chloro-2-methylphenyl)sulfamoyl)phenylboronic acid, 98%, (4-(N-(3-Chloro-2-methylphenyl)sulfamoyl)phenyl)boronic acid 98%, 4-(N-(3-Chloro-2-methylphenyl)sulfamoyl)phenylboronic acid, 98%, 98%, (4-(N-(3-Chloro-2-methylphenyl)sulfamoyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 100g, 1g.
[4-[(3-chloro-2-methylphenyl)sulfamoyl]phenyl]boronic acid (CAS 957066-10-3) is a chemical compound with the molecular formula C13H13BClNO4S and a molecular weight of 325.6 g/mol. IUPAC name: [4-[(3-chloro-2-methylphenyl)sulfamoyl]phenyl]boronic acid. InChIKey: SMPORGPEQYCOAP-UHFFFAOYSA-N.
| Molecular formula | C13H13BClNO4S |
|---|---|
| Molecular weight | 325.6 g/mol |
| IUPAC name | [4-[(3-chloro-2-methylphenyl)sulfamoyl]phenyl]boronic acid |
| InChIKey | SMPORGPEQYCOAP-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)NC2=C(C(=CC=C2)Cl)C)(O)O |
Computed by PubChem (NCBI)