CAS 957111-27-2 appears in our catalog under these names: (S)-2,2'-Dihydroxy-1,1'-binaphthalene-3,3'-diboronic acid, 97%, (R)-(2,2'-Dihydroxy-(1,1'-binaphthalene)-3,3'-diyl)diboronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
[4-(3-borono-2-hydroxynaphthalen-1-yl)-3-hydroxynaphthalen-2-yl]boronic acid (CAS 957111-27-2) is a chemical compound with the molecular formula C20H16B2O6 and a molecular weight of 374.0 g/mol. IUPAC name: [4-(3-borono-2-hydroxynaphthalen-1-yl)-3-hydroxynaphthalen-2-yl]boronic acid. InChIKey: JQGYHOADNLSJJI-UHFFFAOYSA-N.
| Molecular formula | C20H16B2O6 |
|---|---|
| Molecular weight | 374.0 g/mol |
| IUPAC name | [4-(3-borono-2-hydroxynaphthalen-1-yl)-3-hydroxynaphthalen-2-yl]boronic acid |
| InChIKey | JQGYHOADNLSJJI-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=CC=CC=C2C(=C1O)C3=C(C(=CC4=CC=CC=C43)B(O)O)O)(O)O |
Computed by PubChem (NCBI)