Products 957120-34-2

CAS 957120-34-2 is the registry number for 5-Amino-4-chloro-2-fluorobenzoic acid hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

5-amino-4-chloro-2-fluorobenzoic acid;hydrochloride (CAS 957120-34-2) is a chemical compound with the molecular formula C7H6Cl2FNO2 and a molecular weight of 226.03 g/mol. IUPAC name: 5-amino-4-chloro-2-fluorobenzoic acid;hydrochloride. InChIKey: FJPIOMIGSVACGO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6Cl2FNO2
Molecular weight226.03 g/mol
IUPAC name5-amino-4-chloro-2-fluorobenzoic acid;hydrochloride
InChIKeyFJPIOMIGSVACGO-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1N)Cl)F)C(=O)O.Cl

Computed by PubChem (NCBI)