CAS 957120-45-5 appears in our catalog under these names: 2-Methyl-2-(4-boronophenyl)propylamine hydrochloride, 96%, (4-(1-Amino-2-methylpropan-2-yl)phenyl)boronic acid hydrochloride, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
[4-(1-amino-2-methylpropan-2-yl)phenyl]boronic acid;hydrochloride (CAS 957120-45-5) is a chemical compound with the molecular formula C10H17BClNO2 and a molecular weight of 229.51 g/mol. IUPAC name: [4-(1-amino-2-methylpropan-2-yl)phenyl]boronic acid;hydrochloride. InChIKey: DMWSIXKMXBGKNV-UHFFFAOYSA-N.
| Molecular formula | C10H17BClNO2 |
|---|---|
| Molecular weight | 229.51 g/mol |
| IUPAC name | [4-(1-amino-2-methylpropan-2-yl)phenyl]boronic acid;hydrochloride |
| InChIKey | DMWSIXKMXBGKNV-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(C)(C)CN)(O)O.Cl |
Computed by PubChem (NCBI)