CAS 957120-95-5 appears in our catalog under these names: 4-(N-Naphthalen-1-ylsulfamoyl)phenylboronic acid, 96%, (4-(N-(Naphthalen-1-yl)sulfamoyl)phenyl)boronic acid, 96%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
[4-(naphthalen-1-ylsulfamoyl)phenyl]boronic acid (CAS 957120-95-5) is a chemical compound with the molecular formula C16H14BNO4S and a molecular weight of 327.2 g/mol. IUPAC name: [4-(naphthalen-1-ylsulfamoyl)phenyl]boronic acid. InChIKey: UOKSWRGMRNZXCO-UHFFFAOYSA-N.
| Molecular formula | C16H14BNO4S |
|---|---|
| Molecular weight | 327.2 g/mol |
| IUPAC name | [4-(naphthalen-1-ylsulfamoyl)phenyl]boronic acid |
| InChIKey | UOKSWRGMRNZXCO-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC3=CC=CC=C32)(O)O |
Computed by PubChem (NCBI)