CAS 957121-17-4 appears in our catalog under these names: 4-(N-Propionylsulfamoyl)phenylboronic acid, 98%, (4-(N-Propionylsulfamoyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
[4-(propanoylsulfamoyl)phenyl]boronic acid (CAS 957121-17-4) is a chemical compound with the molecular formula C9H12BNO5S and a molecular weight of 257.08 g/mol. IUPAC name: [4-(propanoylsulfamoyl)phenyl]boronic acid. InChIKey: VWEYACLFMKWFQC-UHFFFAOYSA-N.
| Molecular formula | C9H12BNO5S |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | [4-(propanoylsulfamoyl)phenyl]boronic acid |
| InChIKey | VWEYACLFMKWFQC-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)NC(=O)CC)(O)O |
Computed by PubChem (NCBI)