CAS 957144-77-3 appears in our catalog under these names: Dichlobentiazox, >95% (HPLC), Dichlobentiazox. Offered by: TRC, Dr. Ehrenstorfer, Biosynth, HPC Standards. Available pack sizes: 100mg, 250mg, 25mg, 10mg, 1x10mg.
3-[(3,4-dichloro-1,2-thiazol-5-yl)methoxy]-1,2-benzothiazole 1,1-dioxide (CAS 957144-77-3) is a chemical compound with the molecular formula C11H6Cl2N2O3S2 and a molecular weight of 349.2 g/mol. IUPAC name: 3-[(3,4-dichloro-1,2-thiazol-5-yl)methoxy]-1,2-benzothiazole 1,1-dioxide. InChIKey: CUTZZBQQGUIEGT-UHFFFAOYSA-N.
| Molecular formula | C11H6Cl2N2O3S2 |
|---|---|
| Molecular weight | 349.2 g/mol |
| IUPAC name | 3-[(3,4-dichloro-1,2-thiazol-5-yl)methoxy]-1,2-benzothiazole 1,1-dioxide |
| InChIKey | CUTZZBQQGUIEGT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NS2(=O)=O)OCC3=C(C(=NS3)Cl)Cl |
Computed by PubChem (NCBI)