CAS 957198-28-6 is the registry number for 3-Chloro-2-(4-morpholino)pyridine-4-boronic acid pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]morpholine (CAS 957198-28-6) is a chemical compound with the molecular formula C15H22BClN2O3 and a molecular weight of 324.6 g/mol. IUPAC name: 4-[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]morpholine. InChIKey: ALVOSNAIBGPIGV-UHFFFAOYSA-N.
| Molecular formula | C15H22BClN2O3 |
|---|---|
| Molecular weight | 324.6 g/mol |
| IUPAC name | 4-[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]morpholine |
| InChIKey | ALVOSNAIBGPIGV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=NC=C2)N3CCOCC3)Cl |
Computed by PubChem (NCBI)