Products 957624-87-2
CAS 957624-87-2 is the registry number for N-(5-Oxido-2-phenyl-4,6-dihydro-2H-thieno[3,4-c]pyrazol-3-yl)-2-phenylacetamide, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
N-(5-oxo-2-phenyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)-2-phenylacetamide (CAS 957624-87-2) is a chemical compound with the molecular formula C19H17N3O2S and a molecular weight of 351.4 g/mol. IUPAC name: N-(5-oxo-2-phenyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)-2-phenylacetamide. InChIKey: VLPAXNBLNFAYER-UHFFFAOYSA-N.
| Molecular formula | C19H17N3O2S |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | N-(5-oxo-2-phenyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)-2-phenylacetamide |
| InChIKey | VLPAXNBLNFAYER-UHFFFAOYSA-N |
| SMILES | C1C2=C(N(N=C2CS1=O)C3=CC=CC=C3)NC(=O)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)