CAS 957891-15-5 is the registry number for 2–(6–Chloro–4–(4–chlorophenyl)–2–methyl–3–quinolinyl)pentanoic acid. Offered by: GLPBio. Available pack sizes: 10mg.
2-[6-chloro-4-(4-chlorophenyl)-2-methylquinolin-3-yl]pentanoic acid (CAS 957891-15-5) is a chemical compound with the molecular formula C21H19Cl2NO2 and a molecular weight of 388.3 g/mol. IUPAC name: 2-[6-chloro-4-(4-chlorophenyl)-2-methylquinolin-3-yl]pentanoic acid. InChIKey: OIWDYACUWDFFOR-UHFFFAOYSA-N.
| Molecular formula | C21H19Cl2NO2 |
|---|---|
| Molecular weight | 388.3 g/mol |
| IUPAC name | 2-[6-chloro-4-(4-chlorophenyl)-2-methylquinolin-3-yl]pentanoic acid |
| InChIKey | OIWDYACUWDFFOR-UHFFFAOYSA-N |
| SMILES | CCCC(C1=C(N=C2C=CC(=CC2=C1C3=CC=C(C=C3)Cl)Cl)C)C(=O)O |
Computed by PubChem (NCBI)