Products 95796-70-6
CAS 95796-70-6 is the registry number for Theophylline-8-butyric acid lactam. Offered by: Biosynth. Available pack sizes: 500mg, 250mg.
1,3-dimethyl-6,7,8,10-tetrahydropurino[9,8-b]diazepine-2,4,9-trione (CAS 95796-70-6) is a chemical compound with the molecular formula C11H13N5O3 and a molecular weight of 263.25 g/mol. IUPAC name: 1,3-dimethyl-6,7,8,10-tetrahydropurino[9,8-b]diazepine-2,4,9-trione. InChIKey: YDAAJMOFZNETMN-UHFFFAOYSA-N.
| Molecular formula | C11H13N5O3 |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | 1,3-dimethyl-6,7,8,10-tetrahydropurino[9,8-b]diazepine-2,4,9-trione |
| InChIKey | YDAAJMOFZNETMN-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N=C3N2NC(=O)CCC3 |
Computed by PubChem (NCBI)