CAS 958350-60-2 is the registry number for (2S)-2-tert-Butyloxy-butanedioic Acid tert-Butyl Ethyl Ester. Offered by: TRC. Available pack sizes: 100mg, 1g.
1-O-tert-butyl 4-O-ethyl (2S)-2-[(2-methylpropan-2-yl)oxy]butanedioate (CAS 958350-60-2) is a chemical compound with the molecular formula C14H26O5 and a molecular weight of 274.35 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl (2S)-2-[(2-methylpropan-2-yl)oxy]butanedioate. InChIKey: JDULCUXDEORGFW-JTQLQIEISA-N.
| Molecular formula | C14H26O5 |
|---|---|
| Molecular weight | 274.35 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-ethyl (2S)-2-[(2-methylpropan-2-yl)oxy]butanedioate |
| InChIKey | JDULCUXDEORGFW-JTQLQIEISA-N |
| SMILES | CCOC(=O)C[C@@H](C(=O)OC(C)(C)C)OC(C)(C)C |
Computed by PubChem (NCBI)