Products 958350-60-2

CAS 958350-60-2 is the registry number for (2S)-2-tert-Butyloxy-butanedioic Acid tert-Butyl Ethyl Ester. Offered by: TRC. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 4-O-ethyl (2S)-2-[(2-methylpropan-2-yl)oxy]butanedioate (CAS 958350-60-2) is a chemical compound with the molecular formula C14H26O5 and a molecular weight of 274.35 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl (2S)-2-[(2-methylpropan-2-yl)oxy]butanedioate. InChIKey: JDULCUXDEORGFW-JTQLQIEISA-N.

Identity
Molecular formulaC14H26O5
Molecular weight274.35 g/mol
IUPAC name1-O-tert-butyl 4-O-ethyl (2S)-2-[(2-methylpropan-2-yl)oxy]butanedioate
InChIKeyJDULCUXDEORGFW-JTQLQIEISA-N
SMILESCCOC(=O)C[C@@H](C(=O)OC(C)(C)C)OC(C)(C)C

Computed by PubChem (NCBI)