CAS 958447-27-3 appears in our catalog under these names: (2S,3R,6R)-6-Ethyl-3-methyl-2-(3-oxobutyl)-cyclohexanone, Artemisinin impurity 5. Offered by: TRC, Chemat Brand. Available pack sizes: 10mg, 1mg, 5mg, on request.
(2S,3R,6R)-6-ethyl-3-methyl-2-(3-oxobutyl)cyclohexan-1-one (CAS 958447-27-3) is a chemical compound with the molecular formula C13H22O2 and a molecular weight of 210.31 g/mol. IUPAC name: (2S,3R,6R)-6-ethyl-3-methyl-2-(3-oxobutyl)cyclohexan-1-one. InChIKey: DYGZNDLZBYIWGA-JLLWLGSASA-N.
| Molecular formula | C13H22O2 |
|---|---|
| Molecular weight | 210.31 g/mol |
| IUPAC name | (2S,3R,6R)-6-ethyl-3-methyl-2-(3-oxobutyl)cyclohexan-1-one |
| InChIKey | DYGZNDLZBYIWGA-JLLWLGSASA-N |
| SMILES | CC[C@@H]1CC[C@H]([C@@H](C1=O)CCC(=O)C)C |
Computed by PubChem (NCBI)