CAS 958635-15-9 appears in our catalog under these names: (S)-Tetrahydro-1H-oxazolo[3,4-a]pyrazin-3(5H)-one hydrochloride 97%, 3H-Oxazolo[3,4-a]pyrazin-3-one, hexahydro-, hydrochloride (1:1), (8aS)-, 97%, 97%, (S)-Hexahydro-oxazolo[3,4-a]pyrazin-3-one hydrochloride, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
(8aS)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyrazin-3-one;hydrochloride (CAS 958635-15-9) is a chemical compound with the molecular formula C6H11ClN2O2 and a molecular weight of 178.62 g/mol. IUPAC name: (8aS)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyrazin-3-one;hydrochloride. InChIKey: NEFDJLDMYYSLHW-JEDNCBNOSA-N.
| Molecular formula | C6H11ClN2O2 |
|---|---|
| Molecular weight | 178.62 g/mol |
| IUPAC name | (8aS)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyrazin-3-one;hydrochloride |
| InChIKey | NEFDJLDMYYSLHW-JEDNCBNOSA-N |
| SMILES | C1CN2[C@@H](CN1)COC2=O.Cl |
Computed by PubChem (NCBI)