CAS 95873-69-1 is the registry number for Sodium 2-((6-hydroxy-4-methyl-2-oxo-2H-chromen-7-yl)oxy)acetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium 2-(6-hydroxy-4-methyl-2-oxochromen-7-yl)oxyacetate (CAS 95873-69-1) is a chemical compound with the molecular formula C12H9NaO6 and a molecular weight of 272.19 g/mol. IUPAC name: sodium 2-(6-hydroxy-4-methyl-2-oxochromen-7-yl)oxyacetate. InChIKey: CIVAPWNSKCJJEE-UHFFFAOYSA-M.
| Molecular formula | C12H9NaO6 |
|---|---|
| Molecular weight | 272.19 g/mol |
| IUPAC name | sodium 2-(6-hydroxy-4-methyl-2-oxochromen-7-yl)oxyacetate |
| InChIKey | CIVAPWNSKCJJEE-UHFFFAOYSA-M |
| SMILES | CC1=CC(=O)OC2=CC(=C(C=C12)O)OCC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)