Products 95885-56-6
CAS 95885-56-6 is the registry number for 2,4-Diphenyl-4-(phenylmethyl)-5(4H)-oxazolone, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-benzyl-2,4-diphenyl-1,3-oxazol-5-one (CAS 95885-56-6) is a chemical compound with the molecular formula C22H17NO2 and a molecular weight of 327.4 g/mol. IUPAC name: 4-benzyl-2,4-diphenyl-1,3-oxazol-5-one. InChIKey: OLGWZDXJNSMSCP-UHFFFAOYSA-N.
| Molecular formula | C22H17NO2 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 4-benzyl-2,4-diphenyl-1,3-oxazol-5-one |
| InChIKey | OLGWZDXJNSMSCP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2(C(=O)OC(=N2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)