CAS 958965-74-7 is the registry number for (3R)-1,7-Dithia-4-azaspiro[4.4]nonane-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R)-1,7-dithia-4-azaspiro[4.4]nonane-3-carboxylic acid (CAS 958965-74-7) is a chemical compound with the molecular formula C7H11NO2S2 and a molecular weight of 205.3 g/mol. IUPAC name: (3R)-1,7-dithia-4-azaspiro[4.4]nonane-3-carboxylic acid. InChIKey: DFOYWPNNFKSLFW-DSEUIKHZSA-N.
| Molecular formula | C7H11NO2S2 |
|---|---|
| Molecular weight | 205.3 g/mol |
| IUPAC name | (3R)-1,7-dithia-4-azaspiro[4.4]nonane-3-carboxylic acid |
| InChIKey | DFOYWPNNFKSLFW-DSEUIKHZSA-N |
| SMILES | C1CSCC12N[C@@H](CS2)C(=O)O |
Computed by PubChem (NCBI)