CAS 959046-72-1 appears in our catalog under these names: Ethyl 4-(2,4-difluorophenyl)-2,4-dioxobutanoate, 98%, ETHYL 4-(2,4-DIFLUOROPHENYL)-2,4-DIOXOBUTANOATE, 98%, 98%, Ethyl 2,4-difluoro-α,γ-dioxobenzenebutanoate, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
Ethyl 4-(2,4-difluorophenyl)-2,4-dioxobutanoate (CAS 959046-72-1) is a chemical compound with the molecular formula C12H10F2O4 and a molecular weight of 256.20 g/mol. IUPAC name: ethyl 4-(2,4-difluorophenyl)-2,4-dioxobutanoate. InChIKey: GNBIDWSDQWXBSW-UHFFFAOYSA-N.
| Molecular formula | C12H10F2O4 |
|---|---|
| Molecular weight | 256.20 g/mol |
| IUPAC name | ethyl 4-(2,4-difluorophenyl)-2,4-dioxobutanoate |
| InChIKey | GNBIDWSDQWXBSW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CC(=O)C1=C(C=C(C=C1)F)F |
Computed by PubChem (NCBI)