Products 95906-91-5

CAS 95906-91-5 is the registry number for 2-[2-[2-(2-Phenoxyethoxy)ethoxy]ethoxy]ethyl 2-propenoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

2-[2-[2-(2-phenoxyethoxy)ethoxy]ethoxy]ethyl prop-2-enoate (CAS 95906-91-5) is a chemical compound with the molecular formula C17H24O6 and a molecular weight of 324.4 g/mol. IUPAC name: 2-[2-[2-(2-phenoxyethoxy)ethoxy]ethoxy]ethyl prop-2-enoate. InChIKey: KNOKZEPGCZFFQN-UHFFFAOYSA-N.

Identity
Molecular formulaC17H24O6
Molecular weight324.4 g/mol
IUPAC name2-[2-[2-(2-phenoxyethoxy)ethoxy]ethoxy]ethyl prop-2-enoate
InChIKeyKNOKZEPGCZFFQN-UHFFFAOYSA-N
SMILESC=CC(=O)OCCOCCOCCOCCOC1=CC=CC=C1

Computed by PubChem (NCBI)