Products 959239-52-2

CAS 959239-52-2 is the registry number for 2-Methyl-1-(1-methyl-1h-1,2,4-triazol-5-yl)-1-propanone, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.

Structural formula: {0} (CAS {1})

2-methyl-1-(2-methyl-1,2,4-triazol-3-yl)propan-1-one (CAS 959239-52-2) is a chemical compound with the molecular formula C7H11N3O and a molecular weight of 153.18 g/mol. IUPAC name: 2-methyl-1-(2-methyl-1,2,4-triazol-3-yl)propan-1-one. InChIKey: DKCPNVQWASEXSA-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11N3O
Molecular weight153.18 g/mol
IUPAC name2-methyl-1-(2-methyl-1,2,4-triazol-3-yl)propan-1-one
InChIKeyDKCPNVQWASEXSA-UHFFFAOYSA-N
SMILESCC(C)C(=O)C1=NC=NN1C

Computed by PubChem (NCBI)