CAS 959240-74-5 appears in our catalog under these names: 6-Chloro-n,n-dimethyl-2-pyrazinecarboxamide, 95%, 6-Chloro-N,N-dimethylpyrazine-2-carboxamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 0,5g.
6-chloro-N,N-dimethylpyrazine-2-carboxamide (CAS 959240-74-5) is a chemical compound with the molecular formula C7H8ClN3O and a molecular weight of 185.61 g/mol. IUPAC name: 6-chloro-N,N-dimethylpyrazine-2-carboxamide. InChIKey: FAJPFOLFEIYMJX-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3O |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 6-chloro-N,N-dimethylpyrazine-2-carboxamide |
| InChIKey | FAJPFOLFEIYMJX-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CN=CC(=N1)Cl |
Computed by PubChem (NCBI)