Products 95926-89-9

CAS 95926-89-9 is the registry number for Pivalic-d6 Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.

3,3,3-trideuterio-2-methyl-2-(trideuteriomethyl)propanoic acid (CAS 95926-89-9) is a chemical compound with the molecular formula C5H10O2 and a molecular weight of 108.17 g/mol. IUPAC name: 3,3,3-trideuterio-2-methyl-2-(trideuteriomethyl)propanoic acid. InChIKey: IUGYQRQAERSCNH-WFGJKAKNSA-N.

Identity
Molecular formulaC5H10O2
Molecular weight108.17 g/mol
IUPAC name3,3,3-trideuterio-2-methyl-2-(trideuteriomethyl)propanoic acid
InChIKeyIUGYQRQAERSCNH-WFGJKAKNSA-N
SMILES[2H]C([2H])([2H])C(C)(C(=O)O)C([2H])([2H])[2H]

Computed by PubChem (NCBI)

Synonyms: Pivalic-d6 Acid