CAS 95926-89-9 is the registry number for Pivalic-d6 Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
3,3,3-trideuterio-2-methyl-2-(trideuteriomethyl)propanoic acid (CAS 95926-89-9) is a chemical compound with the molecular formula C5H10O2 and a molecular weight of 108.17 g/mol. IUPAC name: 3,3,3-trideuterio-2-methyl-2-(trideuteriomethyl)propanoic acid. InChIKey: IUGYQRQAERSCNH-WFGJKAKNSA-N.
| Molecular formula | C5H10O2 |
|---|---|
| Molecular weight | 108.17 g/mol |
| IUPAC name | 3,3,3-trideuterio-2-methyl-2-(trideuteriomethyl)propanoic acid |
| InChIKey | IUGYQRQAERSCNH-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(C)(C(=O)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)