CAS 95926-99-1 appears in our catalog under these names: 2-Methyl-propanoic-3,3,3-d3 Acid, 2-Methyl-d3-propionic Acid, 99 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 100mg, 25mg, 50mg, 1g, 0,5g.
3,3,3-trideuterio-2-methylpropanoic acid (CAS 95926-99-1) is a chemical compound with the molecular formula C4H8O2 and a molecular weight of 91.12 g/mol. IUPAC name: 3,3,3-trideuterio-2-methylpropanoic acid. InChIKey: KQNPFQTWMSNSAP-FIBGUPNXSA-N.
| Molecular formula | C4H8O2 |
|---|---|
| Molecular weight | 91.12 g/mol |
| IUPAC name | 3,3,3-trideuterio-2-methylpropanoic acid |
| InChIKey | KQNPFQTWMSNSAP-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(C)C(=O)O |
Computed by PubChem (NCBI)