Products 959474-42-1

CAS 959474-42-1 is the registry number for 1,1-Dithiopyrophosphoric Acid. Offered by: TRC. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

[hydroxy(sulfanyl)phosphinothioyl] dihydrogen phosphate (CAS 959474-42-1) is a chemical compound with the molecular formula H4O5P2S2 and a molecular weight of 210.11 g/mol. IUPAC name: [hydroxy(sulfanyl)phosphinothioyl] dihydrogen phosphate. InChIKey: OZQGKWOGOZMTOM-UHFFFAOYSA-N.

Identity
Molecular formulaH4O5P2S2
Molecular weight210.11 g/mol
IUPAC name[hydroxy(sulfanyl)phosphinothioyl] dihydrogen phosphate
InChIKeyOZQGKWOGOZMTOM-UHFFFAOYSA-N
SMILESOP(=O)(O)OP(=S)(O)S

Computed by PubChem (NCBI)