CAS 959571-93-8 is the registry number for HR-73. Offered by: TRC. Available pack sizes: 100mg.
8-bromo-2-phenyl-1,2-dihydrobenzo[f]chromen-3-one (CAS 959571-93-8) is a chemical compound with the molecular formula C19H13BrO2 and a molecular weight of 353.2 g/mol. IUPAC name: 8-bromo-2-phenyl-1,2-dihydrobenzo[f]chromen-3-one. InChIKey: KNCWGGDYISFPIT-UHFFFAOYSA-N.
| Molecular formula | C19H13BrO2 |
|---|---|
| Molecular weight | 353.2 g/mol |
| IUPAC name | 8-bromo-2-phenyl-1,2-dihydrobenzo[f]chromen-3-one |
| InChIKey | KNCWGGDYISFPIT-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)OC2=C1C3=C(C=C2)C=C(C=C3)Br)C4=CC=CC=C4 |
Computed by PubChem (NCBI)