Products 959579-20-5
CAS 959579-20-5 is the registry number for 4-(((4-nitrophenyl)amino)thioxomethyl)piperazinecarbaldehyde. Offered by: Biosynth. Available pack sizes: 250mg.
4-formyl-N-(4-nitrophenyl)piperazine-1-carbothioamide (CAS 959579-20-5) is a chemical compound with the molecular formula C12H14N4O3S and a molecular weight of 294.33 g/mol. IUPAC name: 4-formyl-N-(4-nitrophenyl)piperazine-1-carbothioamide. InChIKey: NLRIKMMRAZECJZ-UHFFFAOYSA-N.
| Molecular formula | C12H14N4O3S |
|---|---|
| Molecular weight | 294.33 g/mol |
| IUPAC name | 4-formyl-N-(4-nitrophenyl)piperazine-1-carbothioamide |
| InChIKey | NLRIKMMRAZECJZ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C=O)C(=S)NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)