CAS 959579-81-8 appears in our catalog under these names: Fmoc-l-2,4,5-trifluorophenylalanine, 95%, Fmoc-L-2,4,5-Trifluorophe 95%, Fmoc-l-2,4,5-trifluorophenylalanine, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2,4,5-trifluorophenyl)propanoic acid (CAS 959579-81-8) is a chemical compound with the molecular formula C24H18F3NO4 and a molecular weight of 441.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2,4,5-trifluorophenyl)propanoic acid. InChIKey: YAHKXQSXDLBLDX-QFIPXVFZSA-N.
| Molecular formula | C24H18F3NO4 |
|---|---|
| Molecular weight | 441.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2,4,5-trifluorophenyl)propanoic acid |
| InChIKey | YAHKXQSXDLBLDX-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC(=C(C=C4F)F)F)C(=O)O |
Computed by PubChem (NCBI)